C8H5F9O — CID 175337746
3,3,4,4,5-pentafluoro-1-(1,2,3,3-tetrafluoropropoxy)cyclopentene (PubChem CID 175337746) has the molecular formula C8H5F9O and a molecular weight of 288.11 g/mol. Its IUPAC name is 3,3,4,4,5-pentafluoro-1-(1,2,3,3-tetrafluoropropoxy)cyclopentene.
| Compound Name | 3,3,4,4,5-pentafluoro-1-(1,2,3,3-tetrafluoropropoxy)cyclopentene |
|---|---|
| PubChem CID | 175337746 |
| Molecular Formula | C8H5F9O |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 3,3,4,4,5-pentafluoro-1-(1,2,3,3-tetrafluoropropoxy)cyclopentene |
| SMILES | FC(F)C(F)C(F)OC1=CC(F)(F)C(F)(F)C1F |
| InChI | InChI=1S/C8H5F9O/c9-3(5(11)12)6(13)18-2-1-7(14,15)8(16,17)4(2)10/h1,3-6H |
| InChIKey | UPWVVOGYNCBUIQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|