C8H2F12O — CID 175337754
1,3,3,4,4,5-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene (PubChem CID 175337754) has the molecular formula C8H2F12O and a molecular weight of 342.08 g/mol. Its IUPAC name is 1,3,3,4,4,5-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene.
| Compound Name | 1,3,3,4,4,5-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
|---|---|
| PubChem CID | 175337754 |
| Molecular Formula | C8H2F12O |
| Molecular Weight | 342.08 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1,3,3,4,4,5-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
| SMILES | FC1=C(OC(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1F |
| InChI | InChI=1S/C8H2F12O/c9-1-2(10)5(11,12)6(13,14)3(1)21-4(7(15,16)17)8(18,19)20/h2,4H |
| InChIKey | ZFQPNXQLMALSGC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.08 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|