C15H24O2S — CID 175337789
3-methyl-2-[(2,3,3-trimethylcyclohexen-1-yl)methyl]-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 175337789) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 3-methyl-2-[(2,3,3-trimethylcyclohexen-1-yl)methyl]-2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-methyl-2-[(2,3,3-trimethylcyclohexen-1-yl)methyl]-2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 175337789 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3-methyl-2-[(2,3,3-trimethylcyclohexen-1-yl)methyl]-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | CC1=CCS(=O)(=O)C1CC1=C(C)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H24O2S/c1-11-7-9-18(16,17)14(11)10-13-6-5-8-15(3,4)12(13)2/h7,14H,5-6,8-10H2,1-4H3 |
| InChIKey | NJCNKJSJUHOFPA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|