About [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate
[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate (PubChem CID 175338177) has the molecular formula C10H11F3N2O3
and a molecular weight of 264.20 g/mol. Its IUPAC name is [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate.
Molecular Properties
| Compound Name | [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate |
| PubChem CID | 175338177 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate |
| SMILES | Cc1cc(COC(N)=O)cnc1OCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3/c1-6-2-7(4-17-9(14)16)3-15-8(6)18-5-10(11,12)13/h2-3H,4-5H2,1H3,(H2,14,16) |
| InChIKey | PWZLEBGGJMPCHB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate?
The IUPAC name of [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate (CID 175338177) is [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate.
What is the SMILES notation for [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate?
The canonical SMILES for [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate is Cc1cc(COC(N)=O)cnc1OCC(F)(F)F.
What is the InChIKey of [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate?
The InChIKey is PWZLEBGGJMPCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O3/c1-6-2-7(4-17-9(14)16)3-15-8(6)18-5-10(11,12)13/h2-3H,4-5H2,1H3,(H2,14,16).
What are the key properties of [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate?
[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate has a molecular weight of 264.20 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl carbamate is sourced from PubChem (CID 175338177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).