About 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium
2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium (PubChem CID 175338229) has the molecular formula C26H19O4PPdS
and a molecular weight of 564.90 g/mol. Its IUPAC name is 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium.
Molecular Properties
| Compound Name | 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium |
| PubChem CID | 175338229 |
| Molecular Formula | C26H19O4PPdS |
| Molecular Weight | 564.90 g/mol |
| Exact Mass | 563.98 |
| IUPAC Name | 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium |
| SMILES | O=S(=O)(O)c1ccccc1P(c1ccccc1)c1ccccc1-c1cc2ccccc2o1.[Pd] |
| InChI | InChI=1S/C26H19O4PS.Pd/c27-32(28,29)26-17-9-8-16-25(26)31(20-11-2-1-3-12-20)24-15-7-5-13-21(24)23-18-19-10-4-6-14-22(19)30-23;/h1-18H,(H,27,28,29); |
| InChIKey | XCOGJXLZFAGLFE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium?
The IUPAC name of 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium (CID 175338229) is 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium.
What is the SMILES notation for 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium?
The canonical SMILES for 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium is O=S(=O)(O)c1ccccc1P(c1ccccc1)c1ccccc1-c1cc2ccccc2o1.[Pd].
What is the InChIKey of 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium?
The InChIKey is XCOGJXLZFAGLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19O4PS.Pd/c27-32(28,29)26-17-9-8-16-25(26)31(20-11-2-1-3-12-20)24-15-7-5-13-21(24)23-18-19-10-4-6-14-22(19)30-23;/h1-18H,(H,27,28,29);.
What are the key properties of 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium?
2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium has a molecular weight of 564.90 g/mol, XLogP of 5.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1-benzofuran-2-yl)phenyl]-phenylphosphanyl]benzenesulfonic acid;palladium is sourced from PubChem (CID 175338229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).