About 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane
1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane (PubChem CID 175338367) has the molecular formula C16H19P
and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane.
Molecular Properties
| Compound Name | 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane |
| PubChem CID | 175338367 |
| Molecular Formula | C16H19P |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane |
| SMILES | C1=CC(c2ccccc2)C(P2CCCCC2)=C1 |
| InChI | InChI=1S/C16H19P/c1-3-8-14(9-4-1)15-10-7-11-16(15)17-12-5-2-6-13-17/h1,3-4,7-11,15H,2,5-6,12-13H2 |
| InChIKey | NJXMFFKHXHCDQF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane?
The IUPAC name of 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane (CID 175338367) is 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane.
What is the SMILES notation for 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane?
The canonical SMILES for 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane is C1=CC(c2ccccc2)C(P2CCCCC2)=C1.
What is the InChIKey of 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane?
The InChIKey is NJXMFFKHXHCDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19P/c1-3-8-14(9-4-1)15-10-7-11-16(15)17-12-5-2-6-13-17/h1,3-4,7-11,15H,2,5-6,12-13H2.
What are the key properties of 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane?
1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane has a molecular weight of 242.30 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-phenylcyclopenta-1,3-dien-1-yl)phosphinane is sourced from PubChem (CID 175338367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).