C8H11N3O3 — CID 175338908
2-[2-(oxiran-2-ylmethoxy)ethoxy]-1,3,5-triazine (PubChem CID 175338908) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-[2-(oxiran-2-ylmethoxy)ethoxy]-1,3,5-triazine.
| Compound Name | 2-[2-(oxiran-2-ylmethoxy)ethoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 175338908 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-[2-(oxiran-2-ylmethoxy)ethoxy]-1,3,5-triazine |
| SMILES | c1ncnc(OCCOCC2CO2)n1 |
| InChI | InChI=1S/C8H11N3O3/c1(12-3-7-4-14-7)2-13-8-10-5-9-6-11-8/h5-7H,1-4H2 |
| InChIKey | REAPBFHCDMQAEQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 69.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|