About sodium;arsoric acid;formate
sodium;arsoric acid;formate (PubChem CID 175339323) has the molecular formula CH4AsNaO6
and a molecular weight of 209.95 g/mol. Its IUPAC name is sodium;arsoric acid;formate.
Molecular Properties
| Compound Name | sodium;arsoric acid;formate |
| PubChem CID | 175339323 |
| Molecular Formula | CH4AsNaO6 |
| Molecular Weight | 209.95 g/mol |
| Exact Mass | 209.91 |
| IUPAC Name | sodium;arsoric acid;formate |
| SMILES | O=C[O-].O=[As](O)(O)O.[Na+] |
| InChI | InChI=1S/CH2O2.AsH3O4.Na/c2-1-3;2-1(3,4)5;/h1H,(H,2,3);(H3,2,3,4,5);/q;;+1/p-1 |
| InChIKey | RACUHKGBOHVPBA-UHFFFAOYSA-M |
| XLogP | -6.80 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.95 |
| LogP ≤ 5 | -6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;arsoric acid;formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;arsoric acid;formate?
The IUPAC name of sodium;arsoric acid;formate (CID 175339323) is sodium;arsoric acid;formate.
What is the SMILES notation for sodium;arsoric acid;formate?
The canonical SMILES for sodium;arsoric acid;formate is O=C[O-].O=[As](O)(O)O.[Na+].
What is the InChIKey of sodium;arsoric acid;formate?
The InChIKey is RACUHKGBOHVPBA-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O2.AsH3O4.Na/c2-1-3;2-1(3,4)5;/h1H,(H,2,3);(H3,2,3,4,5);/q;;+1/p-1.
What are the key properties of sodium;arsoric acid;formate?
sodium;arsoric acid;formate has a molecular weight of 209.95 g/mol, XLogP of -6.80, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;arsoric acid;formate is sourced from PubChem (CID 175339323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).