C19H34F3NO4 — CID 175339697
(2S)-2-[[[(2R,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)nonanoyl]-methylamino]methyl]-4-methylpentanoic acid (PubChem CID 175339697) has the molecular formula C19H34F3NO4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)nonanoyl]-methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[[(2R,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)nonanoyl]-methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175339697 |
| Molecular Formula | C19H34F3NO4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | (2S)-2-[[[(2R,3R)-3-hydroxy-2-(2,2,2-trifluoroethyl)nonanoyl]-methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CCCCCC[C@@H](O)[C@@H](CC(F)(F)F)C(=O)N(C)C[C@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C19H34F3NO4/c1-5-6-7-8-9-16(24)15(11-19(20,21)22)17(25)23(4)12-14(18(26)27)10-13(2)3/h13-16,24H,5-12H2,1-4H3,(H,26,27)/t14-,15+,16+/m0/s1 |
| InChIKey | XGCUUWBWZNTFGV-ARFHVFGLSA-N |
| XLogP | 4.09 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|