About 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide
2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide (PubChem CID 175340314) has the molecular formula C8H16F6N2O2S
and a molecular weight of 318.28 g/mol. Its IUPAC name is 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide |
| PubChem CID | 175340314 |
| Molecular Formula | C8H16F6N2O2S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide |
| SMILES | CC(C)C(C)(C)NC(F)(F)F.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N.CH2F3NO2S/c1-5(2)6(3,4)11-7(8,9)10;2-1(3,4)8(5,6)7/h5,11H,1-4H3;(H2,5,6,7) |
| InChIKey | ODSJYOSKUJNJKX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide?
The IUPAC name of 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide (CID 175340314) is 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide.
What is the SMILES notation for 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide?
The canonical SMILES for 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide is CC(C)C(C)(C)NC(F)(F)F.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide?
The InChIKey is ODSJYOSKUJNJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N.CH2F3NO2S/c1-5(2)6(3,4)11-7(8,9)10;2-1(3,4)8(5,6)7/h5,11H,1-4H3;(H2,5,6,7).
What are the key properties of 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide?
2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide has a molecular weight of 318.28 g/mol, XLogP of 2.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-N-(trifluoromethyl)butan-2-amine;trifluoromethanesulfonamide is sourced from PubChem (CID 175340314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).