C35H37LiO2Si — CID 175340324
lithium 1-[dimethyl-(3-pentan-2-yl-1H-inden-1-yl)silyl]-4-phenyl-6,7-dihydro-5H-s-indacene-1-carboxylate (PubChem CID 175340324) has the molecular formula C35H37LiO2Si and a molecular weight of 524.71 g/mol. Its IUPAC name is lithium 1-[dimethyl-(3-pentan-2-yl-1H-inden-1-yl)silyl]-4-phenyl-6,7-dihydro-5H-s-indacene-1-carboxylate.
| Compound Name | lithium 1-[dimethyl-(3-pentan-2-yl-1H-inden-1-yl)silyl]-4-phenyl-6,7-dihydro-5H-s-indacene-1-carboxylate |
|---|---|
| PubChem CID | 175340324 |
| Molecular Formula | C35H37LiO2Si |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | lithium 1-[dimethyl-(3-pentan-2-yl-1H-inden-1-yl)silyl]-4-phenyl-6,7-dihydro-5H-s-indacene-1-carboxylate |
| SMILES | CCCC(C)C1=CC([Si](C)(C)C2(C(=O)[O-])C=Cc3c2cc2c(c3-c3ccccc3)CCC2)c2ccccc21.[Li+] |
| InChI | InChI=1S/C35H38O2Si.Li/c1-5-12-23(2)30-22-32(28-17-10-9-16-27(28)30)38(3,4)35(34(36)37)20-19-29-31(35)21-25-15-11-18-26(25)33(29)24-13-7-6-8-14-24;/h6-10,13-14,16-17,19-23,32H,5,11-12,15,18H2,1-4H3,(H,36,37);/q;+1/p-1 |
| InChIKey | SWIQLTGIYXIETK-UHFFFAOYSA-M |
| XLogP | 4.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|