C38H34Cl2N4O5 — CID 175341116
N-[3-[6-chloro-1-[[2-chloro-5-[(5-cyano-3-pyridinyl)methoxy]-4-formylphenoxy]methyl]-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]oxypropyl]-2-pyridin-2-ylacetamide (PubChem CID 175341116) has the molecular formula C38H34Cl2N4O5 and a molecular weight of 697.62 g/mol. Its IUPAC name is N-[3-[6-chloro-1-[[2-chloro-5-[(5-cyano-3-pyridinyl)methoxy]-4-formylphenoxy]methyl]-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]oxypropyl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[3-[6-chloro-1-[[2-chloro-5-[(5-cyano-3-pyridinyl)methoxy]-4-formylphenoxy]methyl]-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]oxypropyl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 175341116 |
| Molecular Formula | C38H34Cl2N4O5 |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 696.19 |
| IUPAC Name | N-[3-[6-chloro-1-[[2-chloro-5-[(5-cyano-3-pyridinyl)methoxy]-4-formylphenoxy]methyl]-6-methyl-5-phenylcyclohexa-2,4-dien-1-yl]oxypropyl]-2-pyridin-2-ylacetamide |
| SMILES | CC1(Cl)C(c2ccccc2)=CC=CC1(COc1cc(OCc2cncc(C#N)c2)c(C=O)cc1Cl)OCCCNC(=O)Cc1ccccn1 |
| InChI | InChI=1S/C38H34Cl2N4O5/c1-37(40)32(29-9-3-2-4-10-29)12-7-13-38(37,49-16-8-15-44-36(46)19-31-11-5-6-14-43-31)26-48-35-20-34(30(24-45)18-33(35)39)47-25-28-17-27(21-41)22-42-23-28/h2-7,9-14,17-18,20,22-24H,8,15-16,19,25-26H2,1H3,(H,44,46) |
| InChIKey | JCBDXIUMCUXTEL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|