About dichloroplatinum;2-phenylquinoline
dichloroplatinum;2-phenylquinoline (PubChem CID 175341425) has the molecular formula C15H11Cl2NPt
and a molecular weight of 471.24 g/mol. Its IUPAC name is dichloroplatinum;2-phenylquinoline.
Molecular Properties
| Compound Name | dichloroplatinum;2-phenylquinoline |
| PubChem CID | 175341425 |
| Molecular Formula | C15H11Cl2NPt |
| Molecular Weight | 471.24 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | dichloroplatinum;2-phenylquinoline |
| SMILES | Cl[Pt]Cl.c1ccc(-c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C15H11N.2ClH.Pt/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;;;/h1-11H;2*1H;/q;;;+2/p-2 |
| InChIKey | ORJTYNGGDHRHGX-UHFFFAOYSA-L |
| XLogP | 5.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.24 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichloroplatinum;2-phenylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;2-phenylquinoline?
The IUPAC name of dichloroplatinum;2-phenylquinoline (CID 175341425) is dichloroplatinum;2-phenylquinoline.
What is the SMILES notation for dichloroplatinum;2-phenylquinoline?
The canonical SMILES for dichloroplatinum;2-phenylquinoline is Cl[Pt]Cl.c1ccc(-c2ccc3ccccc3n2)cc1.
What is the InChIKey of dichloroplatinum;2-phenylquinoline?
The InChIKey is ORJTYNGGDHRHGX-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H11N.2ClH.Pt/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;;;/h1-11H;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroplatinum;2-phenylquinoline?
dichloroplatinum;2-phenylquinoline has a molecular weight of 471.24 g/mol, XLogP of 5.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;2-phenylquinoline is sourced from PubChem (CID 175341425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).