About CID 175341725
CID 175341725 (PubChem CID 175341725) has the molecular formula C20H10AlF6N2O2
and a molecular weight of 451.28 g/mol.
Molecular Properties
| Compound Name | CID 175341725 |
| PubChem CID | 175341725 |
| Molecular Formula | C20H10AlF6N2O2 |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc2cccc(O[Al]Oc3cccc4ccc(C(F)(F)F)nc34)c2n1 |
| InChI | InChI=1S/2C10H6F3NO.Al/c2*11-10(12,13)8-5-4-6-2-1-3-7(15)9(6)14-8;/h2*1-5,15H;/q;;+2/p-2 |
| InChIKey | IQLKDAAQASUZHV-UHFFFAOYSA-L |
| XLogP | 5.81 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 175341725 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175341725?
The IUPAC name of CID 175341725 (CID 175341725) is not available.
What is the SMILES notation for CID 175341725?
The canonical SMILES for CID 175341725 is FC(F)(F)c1ccc2cccc(O[Al]Oc3cccc4ccc(C(F)(F)F)nc34)c2n1.
What is the InChIKey of CID 175341725?
The InChIKey is IQLKDAAQASUZHV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H6F3NO.Al/c2*11-10(12,13)8-5-4-6-2-1-3-7(15)9(6)14-8;/h2*1-5,15H;/q;;+2/p-2.
What are the key properties of CID 175341725?
CID 175341725 has a molecular weight of 451.28 g/mol, XLogP of 5.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175341725 is sourced from PubChem (CID 175341725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).