C37H36N2O4 — CID 175342328
5,6,7,8-tetrakis(oxiran-2-ylmethyl)-1,2-diphenyl-9H-fluorene-3,4-diamine (PubChem CID 175342328) has the molecular formula C37H36N2O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is 5,6,7,8-tetrakis(oxiran-2-ylmethyl)-1,2-diphenyl-9H-fluorene-3,4-diamine.
| Compound Name | 5,6,7,8-tetrakis(oxiran-2-ylmethyl)-1,2-diphenyl-9H-fluorene-3,4-diamine |
|---|---|
| PubChem CID | 175342328 |
| Molecular Formula | C37H36N2O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 5,6,7,8-tetrakis(oxiran-2-ylmethyl)-1,2-diphenyl-9H-fluorene-3,4-diamine |
| SMILES | Nc1c(N)c(-c2ccccc2)c(-c2ccccc2)c2c1-c1c(c(CC3CO3)c(CC3CO3)c(CC3CO3)c1CC1CO1)C2 |
| InChI | InChI=1S/C37H36N2O4/c38-36-33(21-9-5-2-6-10-21)32(20-7-3-1-4-8-20)31-15-30-28(13-24-18-42-24)26(11-22-16-40-22)27(12-23-17-41-23)29(14-25-19-43-25)34(30)35(31)37(36)39/h1-10,22-25H,11-19,38-39H2 |
| InChIKey | OHEGPHJHSXNMBR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|