About 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one
1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 175342989) has the molecular formula C11H11F2N3O2S
and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 175342989 |
| Molecular Formula | C11H11F2N3O2S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCn1c(=O)c2[nH]ccc2n(OC2CC2(F)F)c1=S |
| InChI | InChI=1S/C11H11F2N3O2S/c1-2-15-9(17)8-6(3-4-14-8)16(10(15)19)18-7-5-11(7,12)13/h3-4,7,14H,2,5H2,1H3 |
| InChIKey | JUJIYRVTILQHAV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (CID 175342989) is 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one is CCn1c(=O)c2[nH]ccc2n(OC2CC2(F)F)c1=S.
What is the InChIKey of 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is JUJIYRVTILQHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O2S/c1-2-15-9(17)8-6(3-4-14-8)16(10(15)19)18-7-5-11(7,12)13/h3-4,7,14H,2,5H2,1H3.
What are the key properties of 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one?
1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 287.29 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluorocyclopropyl)oxy-3-ethyl-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 175342989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).