About N-methylpropan-1-amine;trifluoromethanesulfonamide
N-methylpropan-1-amine;trifluoromethanesulfonamide (PubChem CID 175343597) has the molecular formula C5H13F3N2O2S
and a molecular weight of 222.23 g/mol. Its IUPAC name is N-methylpropan-1-amine;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-methylpropan-1-amine;trifluoromethanesulfonamide |
| PubChem CID | 175343597 |
| Molecular Formula | C5H13F3N2O2S |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-methylpropan-1-amine;trifluoromethanesulfonamide |
| SMILES | CCCNC.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H11N.CH2F3NO2S/c1-3-4-5-2;2-1(3,4)8(5,6)7/h5H,3-4H2,1-2H3;(H2,5,6,7) |
| InChIKey | YKTLOPRAOCJAOB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylpropan-1-amine;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-1-amine;trifluoromethanesulfonamide?
The IUPAC name of N-methylpropan-1-amine;trifluoromethanesulfonamide (CID 175343597) is N-methylpropan-1-amine;trifluoromethanesulfonamide.
What is the SMILES notation for N-methylpropan-1-amine;trifluoromethanesulfonamide?
The canonical SMILES for N-methylpropan-1-amine;trifluoromethanesulfonamide is CCCNC.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-methylpropan-1-amine;trifluoromethanesulfonamide?
The InChIKey is YKTLOPRAOCJAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.CH2F3NO2S/c1-3-4-5-2;2-1(3,4)8(5,6)7/h5H,3-4H2,1-2H3;(H2,5,6,7).
What are the key properties of N-methylpropan-1-amine;trifluoromethanesulfonamide?
N-methylpropan-1-amine;trifluoromethanesulfonamide has a molecular weight of 222.23 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-1-amine;trifluoromethanesulfonamide is sourced from PubChem (CID 175343597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).