C20H24FN3OS — CID 175344411
6-(2-fluoro-4-pyridinyl)-2-[(3S)-2,5,5-trimethylhexan-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 175344411) has the molecular formula C20H24FN3OS and a molecular weight of 373.50 g/mol. Its IUPAC name is 6-(2-fluoro-4-pyridinyl)-2-[(3S)-2,5,5-trimethylhexan-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(2-fluoro-4-pyridinyl)-2-[(3S)-2,5,5-trimethylhexan-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 175344411 |
| Molecular Formula | C20H24FN3OS |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 6-(2-fluoro-4-pyridinyl)-2-[(3S)-2,5,5-trimethylhexan-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CC(C)[C@H](CC(C)(C)C)c1nc2cc(-c3ccnc(F)c3)sc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H24FN3OS/c1-11(2)13(10-20(3,4)5)18-23-14-9-15(26-17(14)19(25)24-18)12-6-7-22-16(21)8-12/h6-9,11,13H,10H2,1-5H3,(H,23,24,25)/t13-/m0/s1 |
| InChIKey | MZFUBEGWUIONSD-ZDUSSCGKSA-N |
| XLogP | 5.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|