About alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane
alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane (PubChem CID 175344436) has the molecular formula C10H25AlO3
and a molecular weight of 220.29 g/mol. Its IUPAC name is alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane.
Molecular Properties
| Compound Name | alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane |
| PubChem CID | 175344436 |
| Molecular Formula | C10H25AlO3 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane |
| SMILES | CCOC(C)(OC(C)C)OC(C)C.[AlH3] |
| InChI | InChI=1S/C10H22O3.Al.3H/c1-7-11-10(6,12-8(2)3)13-9(4)5;;;;/h8-9H,7H2,1-6H3;;;; |
| InChIKey | DAJZRBGCLCBLHF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane?
The IUPAC name of alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane (CID 175344436) is alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane.
What is the SMILES notation for alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane?
The canonical SMILES for alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane is CCOC(C)(OC(C)C)OC(C)C.[AlH3].
What is the InChIKey of alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane?
The InChIKey is DAJZRBGCLCBLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3.Al.3H/c1-7-11-10(6,12-8(2)3)13-9(4)5;;;;/h8-9H,7H2,1-6H3;;;;.
What are the key properties of alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane?
alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane has a molecular weight of 220.29 g/mol, XLogP of 1.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2-(1-ethoxy-1-propan-2-yloxyethoxy)propane is sourced from PubChem (CID 175344436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).