About 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one
4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 175344533) has the molecular formula C6H3Cl2F3N2O
and a molecular weight of 247.00 g/mol. Its IUPAC name is 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one |
| PubChem CID | 175344533 |
| Molecular Formula | C6H3Cl2F3N2O |
| Molecular Weight | 247.00 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1C(F)C(F)F |
| InChI | InChI=1S/C6H3Cl2F3N2O/c7-2-1-12-13(5(11)4(9)10)6(14)3(2)8/h1,4-5H |
| InChIKey | CKSMMOJDIQQSOK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.00 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one (CID 175344533) is 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one is O=c1c(Cl)c(Cl)cnn1C(F)C(F)F.
What is the InChIKey of 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one?
The InChIKey is CKSMMOJDIQQSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2F3N2O/c7-2-1-12-13(5(11)4(9)10)6(14)3(2)8/h1,4-5H.
What are the key properties of 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one?
4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one has a molecular weight of 247.00 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-(1,2,2-trifluoroethyl)pyridazin-3-one is sourced from PubChem (CID 175344533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).