C9H16Br4O5 — CID 175344641
2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrabromooxolane (PubChem CID 175344641) has the molecular formula C9H16Br4O5 and a molecular weight of 523.84 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrabromooxolane.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrabromooxolane |
|---|---|
| PubChem CID | 175344641 |
| Molecular Formula | C9H16Br4O5 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 519.77 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,2,3,3-tetrabromooxolane |
| SMILES | BrC1(Br)CCOC1(Br)Br.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C4H4Br4O/c6-1-5(2-7,3-8)4-9;5-3(6)1-2-9-4(3,7)8/h6-9H,1-4H2;1-2H2 |
| InChIKey | ZRCZIKQLUUETKO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|