About (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine
(1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine (PubChem CID 175344993) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine.
Molecular Properties
| Compound Name | (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine |
| PubChem CID | 175344993 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine |
| SMILES | CC(N)C1C2CC3CC(C)(C2)CC1(C)C3 |
| InChI | InChI=1S/C14H25N/c1-9(15)12-11-4-10-5-13(2,7-11)8-14(12,3)6-10/h9-12H,4-8,15H2,1-3H3 |
| InChIKey | JYEJXKKMBUWISK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine?
The IUPAC name of (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine (CID 175344993) is (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine.
What is the SMILES notation for (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine?
The canonical SMILES for (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine is CC(N)C1C2CC3CC(C)(C2)CC1(C)C3.
What is the InChIKey of (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine?
The InChIKey is JYEJXKKMBUWISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-9(15)12-11-4-10-5-13(2,7-11)8-14(12,3)6-10/h9-12H,4-8,15H2,1-3H3.
What are the key properties of (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine?
(1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine has a molecular weight of 207.36 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(1,5-dimethyl-2-adamantyl)ethanamine is sourced from PubChem (CID 175344993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).