methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate

C11H8BrF3N2O2 — CID 175345200

IUPACmethyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate
SMILESCOC(=O)c1cc(Br)cc2nn(C(F)C(F)F)cc12
InChIInChI=1S/C11H8BrF3N2O2/c1-19-11(18)6-2-5(12)3-8-7(6)4-17(16-8)10(15)9(13)14/h2-4,9-10H,1H3
InChIKeyFPQCSTCMLSWCDW-UHFFFAOYSA-N
MW337.10 g/mol
LogP3.32
Rot. Bonds3

About methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate

methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate (PubChem CID 175345200) has the molecular formula C11H8BrF3N2O2 and a molecular weight of 337.10 g/mol. Its IUPAC name is methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate
PubChem CID175345200
Molecular FormulaC11H8BrF3N2O2
Molecular Weight337.10 g/mol
Exact Mass335.97
IUPAC Namemethyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate
SMILESCOC(=O)c1cc(Br)cc2nn(C(F)C(F)F)cc12
InChIInChI=1S/C11H8BrF3N2O2/c1-19-11(18)6-2-5(12)3-8-7(6)4-17(16-8)10(15)9(13)14/h2-4,9-10H,1H3
InChIKeyFPQCSTCMLSWCDW-UHFFFAOYSA-N
XLogP3.32
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.10
LogP ≤ 53.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate?
The IUPAC name of methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate (CID 175345200) is methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate.
What is the SMILES notation for methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate?
The canonical SMILES for methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate is COC(=O)c1cc(Br)cc2nn(C(F)C(F)F)cc12.
What is the InChIKey of methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate?
The InChIKey is FPQCSTCMLSWCDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrF3N2O2/c1-19-11(18)6-2-5(12)3-8-7(6)4-17(16-8)10(15)9(13)14/h2-4,9-10H,1H3.
What are the key properties of methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate?
methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate has a molecular weight of 337.10 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate is sourced from PubChem (CID 175345200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).