C11H8BrF3N2O2 — CID 175345200
methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate (PubChem CID 175345200) has the molecular formula C11H8BrF3N2O2 and a molecular weight of 337.10 g/mol. Its IUPAC name is methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate.
| Compound Name | methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate |
|---|---|
| PubChem CID | 175345200 |
| Molecular Formula | C11H8BrF3N2O2 |
| Molecular Weight | 337.10 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | methyl 6-bromo-2-(1,2,2-trifluoroethyl)indazole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2nn(C(F)C(F)F)cc12 |
| InChI | InChI=1S/C11H8BrF3N2O2/c1-19-11(18)6-2-5(12)3-8-7(6)4-17(16-8)10(15)9(13)14/h2-4,9-10H,1H3 |
| InChIKey | FPQCSTCMLSWCDW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.10 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |