C34H43N3O7 — CID 175345501
4-hydroxy-5-[[2-[[2-(3-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-6-phenylhexanoic acid;2-phenylacetamide (PubChem CID 175345501) has the molecular formula C34H43N3O7 and a molecular weight of 605.73 g/mol. Its IUPAC name is 4-hydroxy-5-[[2-[[2-(3-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-6-phenylhexanoic acid;2-phenylacetamide.
| Compound Name | 4-hydroxy-5-[[2-[[2-(3-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-6-phenylhexanoic acid;2-phenylacetamide |
|---|---|
| PubChem CID | 175345501 |
| Molecular Formula | C34H43N3O7 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 4-hydroxy-5-[[2-[[2-(3-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-6-phenylhexanoic acid;2-phenylacetamide |
| SMILES | COc1cccc(CC(=O)NC(C(=O)NC(Cc2ccccc2)C(O)CCC(=O)O)C(C)C)c1.NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H34N2O6.C8H9NO/c1-17(2)25(28-23(30)16-19-10-7-11-20(14-19)34-3)26(33)27-21(22(29)12-13-24(31)32)15-18-8-5-4-6-9-18;9-8(10)6-7-4-2-1-3-5-7/h4-11,14,17,21-22,25,29H,12-13,15-16H2,1-3H3,(H,27,33)(H,28,30)(H,31,32);1-5H,6H2,(H2,9,10) |
| InChIKey | VIPAZIHLBNKSKB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |