C18H27NO3 — CID 175346155
[2,4-dimethyl-6-(3-methylbutanoylamino)phenyl] 3-methylbutanoate (PubChem CID 175346155) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [2,4-dimethyl-6-(3-methylbutanoylamino)phenyl] 3-methylbutanoate.
| Compound Name | [2,4-dimethyl-6-(3-methylbutanoylamino)phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 175346155 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [2,4-dimethyl-6-(3-methylbutanoylamino)phenyl] 3-methylbutanoate |
| SMILES | Cc1cc(C)c(OC(=O)CC(C)C)c(NC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C18H27NO3/c1-11(2)7-16(20)19-15-10-13(5)9-14(6)18(15)22-17(21)8-12(3)4/h9-12H,7-8H2,1-6H3,(H,19,20) |
| InChIKey | RKRROPHCDDGBKW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|