About 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine
5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine (PubChem CID 175346508) has the molecular formula C8H25NOSi4
and a molecular weight of 263.64 g/mol. Its IUPAC name is 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine |
| PubChem CID | 175346508 |
| Molecular Formula | C8H25NOSi4 |
| Molecular Weight | 263.64 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine |
| SMILES | C[Si]1(C)CO[SiH2][SiH2][SiH]1CCCCCN |
| InChI | InChI=1S/C8H25NOSi4/c1-14(2)8-10-11-12-13(14)7-5-3-4-6-9/h13H,3-9,11-12H2,1-2H3 |
| InChIKey | QGVWENMLSJZVAX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.64 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine?
The IUPAC name of 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine (CID 175346508) is 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine.
What is the SMILES notation for 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine?
The canonical SMILES for 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine is C[Si]1(C)CO[SiH2][SiH2][SiH]1CCCCCN.
What is the InChIKey of 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine?
The InChIKey is QGVWENMLSJZVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H25NOSi4/c1-14(2)8-10-11-12-13(14)7-5-3-4-6-9/h13H,3-9,11-12H2,1-2H3.
What are the key properties of 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine?
5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine has a molecular weight of 263.64 g/mol, XLogP of -0.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,5-dimethyloxatetrasilinan-4-yl)pentan-1-amine is sourced from PubChem (CID 175346508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).