C31H33N3O3 — CID 175346683
7-(1,2-dimethylindol-3-yl)-7-[4-(ethylideneamino)-2-hexoxyphenyl]furo[3,4-b]pyridin-5-one (PubChem CID 175346683) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 7-(1,2-dimethylindol-3-yl)-7-[4-(ethylideneamino)-2-hexoxyphenyl]furo[3,4-b]pyridin-5-one.
| Compound Name | 7-(1,2-dimethylindol-3-yl)-7-[4-(ethylideneamino)-2-hexoxyphenyl]furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 175346683 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 7-(1,2-dimethylindol-3-yl)-7-[4-(ethylideneamino)-2-hexoxyphenyl]furo[3,4-b]pyridin-5-one |
| SMILES | C/C=N/c1ccc(C2(c3c(C)n(C)c4ccccc34)OC(=O)c3cccnc32)c(OCCCCCC)c1 |
| InChI | InChI=1S/C31H33N3O3/c1-5-7-8-11-19-36-27-20-22(32-6-2)16-17-25(27)31(29-24(30(35)37-31)14-12-18-33-29)28-21(3)34(4)26-15-10-9-13-23(26)28/h6,9-10,12-18,20H,5,7-8,11,19H2,1-4H3/b32-6+ |
| InChIKey | DQVATLDBAVYTNT-LNMUSBCZSA-N |
| XLogP | 7.03 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|