About 7-hydroxy-1,3,5-trioxocane-2,4-dione
7-hydroxy-1,3,5-trioxocane-2,4-dione (PubChem CID 175346709) has the molecular formula C5H6O6
and a molecular weight of 162.10 g/mol. Its IUPAC name is 7-hydroxy-1,3,5-trioxocane-2,4-dione.
Molecular Properties
| Compound Name | 7-hydroxy-1,3,5-trioxocane-2,4-dione |
| PubChem CID | 175346709 |
| Molecular Formula | C5H6O6 |
| Molecular Weight | 162.10 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 7-hydroxy-1,3,5-trioxocane-2,4-dione |
| SMILES | O=C1OCC(O)COC(=O)O1 |
| InChI | InChI=1S/C5H6O6/c6-3-1-9-4(7)11-5(8)10-2-3/h3,6H,1-2H2 |
| InChIKey | CKMJDJHTYGITRJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.10 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-1,3,5-trioxocane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-1,3,5-trioxocane-2,4-dione?
The IUPAC name of 7-hydroxy-1,3,5-trioxocane-2,4-dione (CID 175346709) is 7-hydroxy-1,3,5-trioxocane-2,4-dione.
What is the SMILES notation for 7-hydroxy-1,3,5-trioxocane-2,4-dione?
The canonical SMILES for 7-hydroxy-1,3,5-trioxocane-2,4-dione is O=C1OCC(O)COC(=O)O1.
What is the InChIKey of 7-hydroxy-1,3,5-trioxocane-2,4-dione?
The InChIKey is CKMJDJHTYGITRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O6/c6-3-1-9-4(7)11-5(8)10-2-3/h3,6H,1-2H2.
What are the key properties of 7-hydroxy-1,3,5-trioxocane-2,4-dione?
7-hydroxy-1,3,5-trioxocane-2,4-dione has a molecular weight of 162.10 g/mol, XLogP of -0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1,3,5-trioxocane-2,4-dione is sourced from PubChem (CID 175346709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).