About dilithium;bis(difluorophosphinate);trifluoroborane
dilithium;bis(difluorophosphinate);trifluoroborane (PubChem CID 175347289) has the molecular formula BF7Li2O4P2
and a molecular weight of 283.62 g/mol. Its IUPAC name is dilithium;bis(difluorophosphinate);trifluoroborane.
Molecular Properties
| Compound Name | dilithium;bis(difluorophosphinate);trifluoroborane |
| PubChem CID | 175347289 |
| Molecular Formula | BF7Li2O4P2 |
| Molecular Weight | 283.62 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | dilithium;bis(difluorophosphinate);trifluoroborane |
| SMILES | FB(F)F.O=P([O-])(F)F.O=P([O-])(F)F.[Li+].[Li+] |
| InChI | InChI=1S/BF3.2F2HO2P.2Li/c2-1(3)4;2*1-5(2,3)4;;/h;2*(H,3,4);;/q;;;2*+1/p-2 |
| InChIKey | YQFWRZBPIATFMN-UHFFFAOYSA-L |
| XLogP | -4.32 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.62 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dilithium;bis(difluorophosphinate);trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;bis(difluorophosphinate);trifluoroborane?
The IUPAC name of dilithium;bis(difluorophosphinate);trifluoroborane (CID 175347289) is dilithium;bis(difluorophosphinate);trifluoroborane.
What is the SMILES notation for dilithium;bis(difluorophosphinate);trifluoroborane?
The canonical SMILES for dilithium;bis(difluorophosphinate);trifluoroborane is FB(F)F.O=P([O-])(F)F.O=P([O-])(F)F.[Li+].[Li+].
What is the InChIKey of dilithium;bis(difluorophosphinate);trifluoroborane?
The InChIKey is YQFWRZBPIATFMN-UHFFFAOYSA-L. The full InChI is InChI=1S/BF3.2F2HO2P.2Li/c2-1(3)4;2*1-5(2,3)4;;/h;2*(H,3,4);;/q;;;2*+1/p-2.
What are the key properties of dilithium;bis(difluorophosphinate);trifluoroborane?
dilithium;bis(difluorophosphinate);trifluoroborane has a molecular weight of 283.62 g/mol, XLogP of -4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;bis(difluorophosphinate);trifluoroborane is sourced from PubChem (CID 175347289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).