C20H16ClF3N2O — CID 175347600
5-chloro-N-cyclopropyl-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carboxamide (PubChem CID 175347600) has the molecular formula C20H16ClF3N2O and a molecular weight of 392.81 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carboxamide.
| Compound Name | 5-chloro-N-cyclopropyl-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carboxamide |
|---|---|
| PubChem CID | 175347600 |
| Molecular Formula | C20H16ClF3N2O |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 5-chloro-N-cyclopropyl-1-[[4-(trifluoromethyl)phenyl]methyl]indole-7-carboxamide |
| SMILES | O=C(NC1CC1)c1cc(Cl)cc2ccn(Cc3ccc(C(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C20H16ClF3N2O/c21-15-9-13-7-8-26(11-12-1-3-14(4-2-12)20(22,23)24)18(13)17(10-15)19(27)25-16-5-6-16/h1-4,7-10,16H,5-6,11H2,(H,25,27) |
| InChIKey | PLNUGIDYMXAHGM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |