About acetonitrile;(piperidin-3-ylamino)thiourea
acetonitrile;(piperidin-3-ylamino)thiourea (PubChem CID 175347999) has the molecular formula C8H17N5S
and a molecular weight of 215.33 g/mol. Its IUPAC name is acetonitrile;(piperidin-3-ylamino)thiourea.
Molecular Properties
| Compound Name | acetonitrile;(piperidin-3-ylamino)thiourea |
| PubChem CID | 175347999 |
| Molecular Formula | C8H17N5S |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | acetonitrile;(piperidin-3-ylamino)thiourea |
| SMILES | CC#N.NC(=S)NNC1CCCNC1 |
| InChI | InChI=1S/C6H14N4S.C2H3N/c7-6(11)10-9-5-2-1-3-8-4-5;1-2-3/h5,8-9H,1-4H2,(H3,7,10,11);1H3 |
| InChIKey | PAWOKKIQEIADHY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;(piperidin-3-ylamino)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;(piperidin-3-ylamino)thiourea?
The IUPAC name of acetonitrile;(piperidin-3-ylamino)thiourea (CID 175347999) is acetonitrile;(piperidin-3-ylamino)thiourea.
What is the SMILES notation for acetonitrile;(piperidin-3-ylamino)thiourea?
The canonical SMILES for acetonitrile;(piperidin-3-ylamino)thiourea is CC#N.NC(=S)NNC1CCCNC1.
What is the InChIKey of acetonitrile;(piperidin-3-ylamino)thiourea?
The InChIKey is PAWOKKIQEIADHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N4S.C2H3N/c7-6(11)10-9-5-2-1-3-8-4-5;1-2-3/h5,8-9H,1-4H2,(H3,7,10,11);1H3.
What are the key properties of acetonitrile;(piperidin-3-ylamino)thiourea?
acetonitrile;(piperidin-3-ylamino)thiourea has a molecular weight of 215.33 g/mol, XLogP of -0.39, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;(piperidin-3-ylamino)thiourea is sourced from PubChem (CID 175347999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).