C11H20F5NOS — CID 175348825
tert-butyl-oxido-[(1,1,4,5,5-pentafluoro-2,2-dimethylpentan-3-yl)amino]sulfanium (PubChem CID 175348825) has the molecular formula C11H20F5NOS and a molecular weight of 309.34 g/mol. Its IUPAC name is tert-butyl-oxido-[(1,1,4,5,5-pentafluoro-2,2-dimethylpentan-3-yl)amino]sulfanium.
| Compound Name | tert-butyl-oxido-[(1,1,4,5,5-pentafluoro-2,2-dimethylpentan-3-yl)amino]sulfanium |
|---|---|
| PubChem CID | 175348825 |
| Molecular Formula | C11H20F5NOS |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | tert-butyl-oxido-[(1,1,4,5,5-pentafluoro-2,2-dimethylpentan-3-yl)amino]sulfanium |
| SMILES | CC(C)(C(F)F)C(N[S+]([O-])C(C)(C)C)C(F)C(F)F |
| InChI | InChI=1S/C11H20F5NOS/c1-10(2,3)19(18)17-7(6(12)8(13)14)11(4,5)9(15)16/h6-9,17H,1-5H3 |
| InChIKey | QCVHEWYJKBYHKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|