C19H14Cl3NO — CID 175348866
4,4,4-trichloro-1-(4-quinolin-4-ylphenyl)butan-1-one (PubChem CID 175348866) has the molecular formula C19H14Cl3NO and a molecular weight of 378.69 g/mol. Its IUPAC name is 4,4,4-trichloro-1-(4-quinolin-4-ylphenyl)butan-1-one.
| Compound Name | 4,4,4-trichloro-1-(4-quinolin-4-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 175348866 |
| Molecular Formula | C19H14Cl3NO |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 4,4,4-trichloro-1-(4-quinolin-4-ylphenyl)butan-1-one |
| SMILES | O=C(CCC(Cl)(Cl)Cl)c1ccc(-c2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C19H14Cl3NO/c20-19(21,22)11-9-18(24)14-7-5-13(6-8-14)15-10-12-23-17-4-2-1-3-16(15)17/h1-8,10,12H,9,11H2 |
| InChIKey | RERRDTOJAJRTEH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|