About 4-(methylamino)butan-2-ol;thiophene
4-(methylamino)butan-2-ol;thiophene (PubChem CID 175349022) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is 4-(methylamino)butan-2-ol;thiophene.
Molecular Properties
| Compound Name | 4-(methylamino)butan-2-ol;thiophene |
| PubChem CID | 175349022 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-(methylamino)butan-2-ol;thiophene |
| SMILES | CNCCC(C)O.c1ccsc1 |
| InChI | InChI=1S/C5H13NO.C4H4S/c1-5(7)3-4-6-2;1-2-4-5-3-1/h5-7H,3-4H2,1-2H3;1-4H |
| InChIKey | RIZKTHWZJIGJPL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(methylamino)butan-2-ol;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)butan-2-ol;thiophene?
The IUPAC name of 4-(methylamino)butan-2-ol;thiophene (CID 175349022) is 4-(methylamino)butan-2-ol;thiophene.
What is the SMILES notation for 4-(methylamino)butan-2-ol;thiophene?
The canonical SMILES for 4-(methylamino)butan-2-ol;thiophene is CNCCC(C)O.c1ccsc1.
What is the InChIKey of 4-(methylamino)butan-2-ol;thiophene?
The InChIKey is RIZKTHWZJIGJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO.C4H4S/c1-5(7)3-4-6-2;1-2-4-5-3-1/h5-7H,3-4H2,1-2H3;1-4H.
What are the key properties of 4-(methylamino)butan-2-ol;thiophene?
4-(methylamino)butan-2-ol;thiophene has a molecular weight of 187.31 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)butan-2-ol;thiophene is sourced from PubChem (CID 175349022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).