acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid

C12H14N4O4 — CID 175349692

IUPACacetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid
SMILESCC(=O)O.Cc1ccc(-n2nnc(C)c2C(=O)O)cn1
InChIInChI=1S/C10H10N4O2.C2H4O2/c1-6-3-4-8(5-11-6)14-9(10(15)16)7(2)12-13-14;1-2(3)4/h3-5H,1-2H3,(H,15,16);1H3,(H,3,4)
InChIKeyQCJNCQLCMDDMFX-UHFFFAOYSA-N
MW278.27 g/mol
LogP1.07
Rot. Bonds2

About acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid

acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid (PubChem CID 175349692) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid.

Molecular Properties

Compound Nameacetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid
PubChem CID175349692
Molecular FormulaC12H14N4O4
Molecular Weight278.27 g/mol
Exact Mass278.10
IUPAC Nameacetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid
SMILESCC(=O)O.Cc1ccc(-n2nnc(C)c2C(=O)O)cn1
InChIInChI=1S/C10H10N4O2.C2H4O2/c1-6-3-4-8(5-11-6)14-9(10(15)16)7(2)12-13-14;1-2(3)4/h3-5H,1-2H3,(H,15,16);1H3,(H,3,4)
InChIKeyQCJNCQLCMDDMFX-UHFFFAOYSA-N
XLogP1.07
TPSA118.20 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.27
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid?
The IUPAC name of acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid (CID 175349692) is acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid.
What is the SMILES notation for acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid?
The canonical SMILES for acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid is CC(=O)O.Cc1ccc(-n2nnc(C)c2C(=O)O)cn1.
What is the InChIKey of acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid?
The InChIKey is QCJNCQLCMDDMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2.C2H4O2/c1-6-3-4-8(5-11-6)14-9(10(15)16)7(2)12-13-14;1-2(3)4/h3-5H,1-2H3,(H,15,16);1H3,(H,3,4).
What are the key properties of acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid?
acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid has a molecular weight of 278.27 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;5-methyl-3-(6-methyl-3-pyridinyl)triazole-4-carboxylic acid is sourced from PubChem (CID 175349692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).