About 4-aminobenzamide;4-bromothiophene-2-carbaldehyde
4-aminobenzamide;4-bromothiophene-2-carbaldehyde (PubChem CID 175349931) has the molecular formula C12H11BrN2O2S
and a molecular weight of 327.20 g/mol. Its IUPAC name is 4-aminobenzamide;4-bromothiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-aminobenzamide;4-bromothiophene-2-carbaldehyde |
| PubChem CID | 175349931 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-aminobenzamide;4-bromothiophene-2-carbaldehyde |
| SMILES | NC(=O)c1ccc(N)cc1.O=Cc1cc(Br)cs1 |
| InChI | InChI=1S/C7H8N2O.C5H3BrOS/c8-6-3-1-5(2-4-6)7(9)10;6-4-1-5(2-7)8-3-4/h1-4H,8H2,(H2,9,10);1-3H |
| InChIKey | QQUHRZMNPGLDIN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzamide;4-bromothiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzamide;4-bromothiophene-2-carbaldehyde?
The IUPAC name of 4-aminobenzamide;4-bromothiophene-2-carbaldehyde (CID 175349931) is 4-aminobenzamide;4-bromothiophene-2-carbaldehyde.
What is the SMILES notation for 4-aminobenzamide;4-bromothiophene-2-carbaldehyde?
The canonical SMILES for 4-aminobenzamide;4-bromothiophene-2-carbaldehyde is NC(=O)c1ccc(N)cc1.O=Cc1cc(Br)cs1.
What is the InChIKey of 4-aminobenzamide;4-bromothiophene-2-carbaldehyde?
The InChIKey is QQUHRZMNPGLDIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C5H3BrOS/c8-6-3-1-5(2-4-6)7(9)10;6-4-1-5(2-7)8-3-4/h1-4H,8H2,(H2,9,10);1-3H.
What are the key properties of 4-aminobenzamide;4-bromothiophene-2-carbaldehyde?
4-aminobenzamide;4-bromothiophene-2-carbaldehyde has a molecular weight of 327.20 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzamide;4-bromothiophene-2-carbaldehyde is sourced from PubChem (CID 175349931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).