About N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid
N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid (PubChem CID 175350512) has the molecular formula C21H19F2N3O3
and a molecular weight of 399.40 g/mol. Its IUPAC name is N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid.
Molecular Properties
| Compound Name | N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid |
| PubChem CID | 175350512 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid |
| SMILES | Cc1ccc(F)cc1C(=O)/N=C/N(C)C.O=C(O)c1nccc2ccc(F)cc12 |
| InChI | InChI=1S/C11H13FN2O.C10H6FNO2/c1-8-4-5-9(12)6-10(8)11(15)13-7-14(2)3;11-7-2-1-6-3-4-12-9(10(13)14)8(6)5-7/h4-7H,1-3H3;1-5H,(H,13,14)/b13-7+; |
| InChIKey | KVWOGPFSBUADJE-FTPOTTDRSA-N |
| XLogP | 3.94 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid?
The IUPAC name of N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid (CID 175350512) is N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid.
What is the SMILES notation for N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid?
The canonical SMILES for N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid is Cc1ccc(F)cc1C(=O)/N=C/N(C)C.O=C(O)c1nccc2ccc(F)cc12.
What is the InChIKey of N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid?
The InChIKey is KVWOGPFSBUADJE-FTPOTTDRSA-N. The full InChI is InChI=1S/C11H13FN2O.C10H6FNO2/c1-8-4-5-9(12)6-10(8)11(15)13-7-14(2)3;11-7-2-1-6-3-4-12-9(10(13)14)8(6)5-7/h4-7H,1-3H3;1-5H,(H,13,14)/b13-7+;.
What are the key properties of N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid?
N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid has a molecular weight of 399.40 g/mol, XLogP of 3.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dimethylaminomethylidene)-5-fluoro-2-methylbenzamide;7-fluoroisoquinoline-1-carboxylic acid is sourced from PubChem (CID 175350512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).