About 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide
1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide (PubChem CID 175350547) has the molecular formula C18H40IO2P
and a molecular weight of 446.39 g/mol. Its IUPAC name is 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide.
Molecular Properties
| Compound Name | 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide |
| PubChem CID | 175350547 |
| Molecular Formula | C18H40IO2P |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide |
| SMILES | CCCOC1(OCCC)CCCCCCCC1.CP(C)C.I |
| InChI | InChI=1S/C15H30O2.C3H9P.HI/c1-3-13-16-15(17-14-4-2)11-9-7-5-6-8-10-12-15;1-4(2)3;/h3-14H2,1-2H3;1-3H3;1H |
| InChIKey | JRWZJWLUEGZTGO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide?
The IUPAC name of 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide (CID 175350547) is 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide.
What is the SMILES notation for 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide?
The canonical SMILES for 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide is CCCOC1(OCCC)CCCCCCCC1.CP(C)C.I.
What is the InChIKey of 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide?
The InChIKey is JRWZJWLUEGZTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2.C3H9P.HI/c1-3-13-16-15(17-14-4-2)11-9-7-5-6-8-10-12-15;1-4(2)3;/h3-14H2,1-2H3;1-3H3;1H.
What are the key properties of 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide?
1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide has a molecular weight of 446.39 g/mol, XLogP of 6.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipropoxycyclononane;trimethylphosphane;hydroiodide is sourced from PubChem (CID 175350547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).