C19H39N2O5P — CID 175350570
propan-2-yl 2-[[amino-(1-hexoxy-2-methyl-1-oxopropan-2-yl)phosphoryl]amino]-4-methylpentanoate (PubChem CID 175350570) has the molecular formula C19H39N2O5P and a molecular weight of 406.50 g/mol. Its IUPAC name is propan-2-yl 2-[[amino-(1-hexoxy-2-methyl-1-oxopropan-2-yl)phosphoryl]amino]-4-methylpentanoate.
| Compound Name | propan-2-yl 2-[[amino-(1-hexoxy-2-methyl-1-oxopropan-2-yl)phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 175350570 |
| Molecular Formula | C19H39N2O5P |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | propan-2-yl 2-[[amino-(1-hexoxy-2-methyl-1-oxopropan-2-yl)phosphoryl]amino]-4-methylpentanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)P(N)(=O)NC(CC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C19H39N2O5P/c1-8-9-10-11-12-25-18(23)19(6,7)27(20,24)21-16(13-14(2)3)17(22)26-15(4)5/h14-16H,8-13H2,1-7H3,(H3,20,21,24) |
| InChIKey | JIQFCZXUFJHTMP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|