About phenanthrene;quinazoline
phenanthrene;quinazoline (PubChem CID 175352249) has the molecular formula C22H16N2
and a molecular weight of 308.38 g/mol. Its IUPAC name is phenanthrene;quinazoline.
Molecular Properties
| Compound Name | phenanthrene;quinazoline |
| PubChem CID | 175352249 |
| Molecular Formula | C22H16N2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | phenanthrene;quinazoline |
| SMILES | c1ccc2c(c1)ccc1ccccc12.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C14H10.C8H6N2/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2-4-8-7(3-1)5-9-6-10-8/h1-10H;1-6H |
| InChIKey | DLMWEPFQQBVUIE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;quinazoline?
The IUPAC name of phenanthrene;quinazoline (CID 175352249) is phenanthrene;quinazoline.
What is the SMILES notation for phenanthrene;quinazoline?
The canonical SMILES for phenanthrene;quinazoline is c1ccc2c(c1)ccc1ccccc12.c1ccc2ncncc2c1.
What is the InChIKey of phenanthrene;quinazoline?
The InChIKey is DLMWEPFQQBVUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C8H6N2/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2-4-8-7(3-1)5-9-6-10-8/h1-10H;1-6H.
What are the key properties of phenanthrene;quinazoline?
phenanthrene;quinazoline has a molecular weight of 308.38 g/mol, XLogP of 5.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;quinazoline is sourced from PubChem (CID 175352249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).