C21H35N3O — CID 175352570
[(5R,6S)-5-[(1S,3aS,4S,5S,7R,7aR)-4-(aminomethyl)-1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 175352570) has the molecular formula C21H35N3O and a molecular weight of 345.53 g/mol. Its IUPAC name is [(5R,6S)-5-[(1S,3aS,4S,5S,7R,7aR)-4-(aminomethyl)-1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [(5R,6S)-5-[(1S,3aS,4S,5S,7R,7aR)-4-(aminomethyl)-1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 175352570 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | [(5R,6S)-5-[(1S,3aS,4S,5S,7R,7aR)-4-(aminomethyl)-1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | C[C@@H]1C[C@H]([C@@]2(C)Cc3cn[nH]c3C[C@@H]2CO)[C@@H](CN)[C@H]2CC[C@H](C)[C@@H]21 |
| InChI | InChI=1S/C21H35N3O/c1-12-4-5-16-17(9-22)18(6-13(2)20(12)16)21(3)8-14-10-23-24-19(14)7-15(21)11-25/h10,12-13,15-18,20,25H,4-9,11,22H2,1-3H3,(H,23,24)/t12-,13+,15+,16+,17-,18-,20+,21-/m0/s1 |
| InChIKey | YOGJOCCDSWYPHC-IDAIDAARSA-N |
| XLogP | 3.02 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |