C12H16N2O4S — CID 175352740
1-[(5-cyclopropyloxy-2-pyridinyl)methyl]azetidine-3-sulfonic acid (PubChem CID 175352740) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[(5-cyclopropyloxy-2-pyridinyl)methyl]azetidine-3-sulfonic acid.
| Compound Name | 1-[(5-cyclopropyloxy-2-pyridinyl)methyl]azetidine-3-sulfonic acid |
|---|---|
| PubChem CID | 175352740 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[(5-cyclopropyloxy-2-pyridinyl)methyl]azetidine-3-sulfonic acid |
| SMILES | O=S(=O)(O)C1CN(Cc2ccc(OC3CC3)cn2)C1 |
| InChI | InChI=1S/C12H16N2O4S/c15-19(16,17)12-7-14(8-12)6-9-1-2-11(5-13-9)18-10-3-4-10/h1-2,5,10,12H,3-4,6-8H2,(H,15,16,17) |
| InChIKey | AFPUUVRTZXSYIZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|