About [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate
[2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 175353107) has the molecular formula C27H23N3O3
and a molecular weight of 437.50 g/mol. Its IUPAC name is [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 175353107 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1cc2oc(-c3cccc(-c4ccccc4)c3C#N)nc2cc1COC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C27H23N3O3/c1-17-13-25-24(14-19(17)16-32-27(31)23-11-6-12-29-23)30-26(33-25)21-10-5-9-20(22(21)15-28)18-7-3-2-4-8-18/h2-5,7-10,13-14,23,29H,6,11-12,16H2,1H3/t23-/m0/s1 |
| InChIKey | ALKNUUPSXUSJRA-QHCPKHFHSA-N |
| XLogP | 5.14 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate (CID 175353107) is [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate is Cc1cc2oc(-c3cccc(-c4ccccc4)c3C#N)nc2cc1COC(=O)[C@@H]1CCCN1.
What is the InChIKey of [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate?
The InChIKey is ALKNUUPSXUSJRA-QHCPKHFHSA-N. The full InChI is InChI=1S/C27H23N3O3/c1-17-13-25-24(14-19(17)16-32-27(31)23-11-6-12-29-23)30-26(33-25)21-10-5-9-20(22(21)15-28)18-7-3-2-4-8-18/h2-5,7-10,13-14,23,29H,6,11-12,16H2,1H3/t23-/m0/s1.
What are the key properties of [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate?
[2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate has a molecular weight of 437.50 g/mol, XLogP of 5.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-cyano-3-phenylphenyl)-6-methyl-1,3-benzoxazol-5-yl]methyl (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 175353107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).