C24H31NO5 — CID 175353152
3-[[6-hydroxy-3,4-dioxo-5-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-1,5-dien-1-yl]amino]propanoic acid (PubChem CID 175353152) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 3-[[6-hydroxy-3,4-dioxo-5-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-1,5-dien-1-yl]amino]propanoic acid.
| Compound Name | 3-[[6-hydroxy-3,4-dioxo-5-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-1,5-dien-1-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 175353152 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3-[[6-hydroxy-3,4-dioxo-5-[[(1R,2S,4R)-1,2,4-trimethyl-5-methylidene-2,3,4,6,7,8-hexahydronaphthalen-1-yl]methyl]cyclohexa-1,5-dien-1-yl]amino]propanoic acid |
| SMILES | C=C1CCCC2=C1[C@H](C)C[C@H](C)[C@@]2(C)CC1=C(O)C(NCCC(=O)O)=CC(=O)C1=O |
| InChI | InChI=1S/C24H31NO5/c1-13-6-5-7-17-21(13)14(2)10-15(3)24(17,4)12-16-22(29)18(11-19(26)23(16)30)25-9-8-20(27)28/h11,14-15,25,29H,1,5-10,12H2,2-4H3,(H,27,28)/t14-,15+,24-/m1/s1 |
| InChIKey | IUPANZQMKHJRPI-JPMUSVJPSA-N |
| XLogP | 4.01 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|