C18H22BrNO2S — CID 175354339
ethylbenzene;propan-2-yl N-(4-bromo-3-sulfanylphenyl)carbamate (PubChem CID 175354339) has the molecular formula C18H22BrNO2S and a molecular weight of 396.35 g/mol. Its IUPAC name is ethylbenzene;propan-2-yl N-(4-bromo-3-sulfanylphenyl)carbamate.
| Compound Name | ethylbenzene;propan-2-yl N-(4-bromo-3-sulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 175354339 |
| Molecular Formula | C18H22BrNO2S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | ethylbenzene;propan-2-yl N-(4-bromo-3-sulfanylphenyl)carbamate |
| SMILES | CC(C)OC(=O)Nc1ccc(Br)c(S)c1.CCc1ccccc1 |
| InChI | InChI=1S/C10H12BrNO2S.C8H10/c1-6(2)14-10(13)12-7-3-4-8(11)9(15)5-7;1-2-8-6-4-3-5-7-8/h3-6,15H,1-2H3,(H,12,13);3-7H,2H2,1H3 |
| InChIKey | XQEIDJWXKKDFQV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|