C15H23NO2S — CID 175354624
ethyl 2-thiocyanato-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 175354624) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is ethyl 2-thiocyanato-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | ethyl 2-thiocyanato-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 175354624 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl 2-thiocyanato-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | CCOC(=O)C(SC#N)C1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C15H23NO2S/c1-5-18-13(17)12(19-9-16)11-8-10-6-7-15(11,4)14(10,2)3/h10-12H,5-8H2,1-4H3/t10-,11?,12?,15-/m1/s1 |
| InChIKey | CFSHJZMDOBGZDR-TVRADYJESA-N |
| XLogP | 3.59 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|