About 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene
7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene (PubChem CID 175354901) has the molecular formula C10H13Br
and a molecular weight of 213.12 g/mol. Its IUPAC name is 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene.
Molecular Properties
| Compound Name | 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene |
| PubChem CID | 175354901 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene |
| SMILES | CC1CC=C2CCCC(Br)=C21 |
| InChI | InChI=1S/C10H13Br/c1-7-5-6-8-3-2-4-9(11)10(7)8/h6-7H,2-5H2,1H3 |
| InChIKey | NYKIPQMEABXKIT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene?
The IUPAC name of 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene (CID 175354901) is 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene.
What is the SMILES notation for 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene?
The canonical SMILES for 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene is CC1CC=C2CCCC(Br)=C21.
What is the InChIKey of 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene?
The InChIKey is NYKIPQMEABXKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Br/c1-7-5-6-8-3-2-4-9(11)10(7)8/h6-7H,2-5H2,1H3.
What are the key properties of 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene?
7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene has a molecular weight of 213.12 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-methyl-2,4,5,6-tetrahydro-1H-indene is sourced from PubChem (CID 175354901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).