About 4,5-dihydro-1H-imidazole;2-methylidenebutanamide
4,5-dihydro-1H-imidazole;2-methylidenebutanamide (PubChem CID 175355047) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;2-methylidenebutanamide.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazole;2-methylidenebutanamide |
| PubChem CID | 175355047 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;2-methylidenebutanamide |
| SMILES | C1=NCCN1.C=C(CC)C(N)=O |
| InChI | InChI=1S/C5H9NO.C3H6N2/c1-3-4(2)5(6)7;1-2-5-3-4-1/h2-3H2,1H3,(H2,6,7);3H,1-2H2,(H,4,5) |
| InChIKey | NRKFLGWCEYLHRW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1H-imidazole;2-methylidenebutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazole;2-methylidenebutanamide?
The IUPAC name of 4,5-dihydro-1H-imidazole;2-methylidenebutanamide (CID 175355047) is 4,5-dihydro-1H-imidazole;2-methylidenebutanamide.
What is the SMILES notation for 4,5-dihydro-1H-imidazole;2-methylidenebutanamide?
The canonical SMILES for 4,5-dihydro-1H-imidazole;2-methylidenebutanamide is C1=NCCN1.C=C(CC)C(N)=O.
What is the InChIKey of 4,5-dihydro-1H-imidazole;2-methylidenebutanamide?
The InChIKey is NRKFLGWCEYLHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H6N2/c1-3-4(2)5(6)7;1-2-5-3-4-1/h2-3H2,1H3,(H2,6,7);3H,1-2H2,(H,4,5).
What are the key properties of 4,5-dihydro-1H-imidazole;2-methylidenebutanamide?
4,5-dihydro-1H-imidazole;2-methylidenebutanamide has a molecular weight of 169.23 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazole;2-methylidenebutanamide is sourced from PubChem (CID 175355047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).