C12H13N3S — CID 175355570
3-methyl-6-(1-phenylethyl)-2H-1,2,4-triazine-5-thione (PubChem CID 175355570) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-methyl-6-(1-phenylethyl)-2H-1,2,4-triazine-5-thione.
| Compound Name | 3-methyl-6-(1-phenylethyl)-2H-1,2,4-triazine-5-thione |
|---|---|
| PubChem CID | 175355570 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-methyl-6-(1-phenylethyl)-2H-1,2,4-triazine-5-thione |
| SMILES | Cc1nc(=S)c(C(C)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C12H13N3S/c1-8(10-6-4-3-5-7-10)11-12(16)13-9(2)14-15-11/h3-8H,1-2H3,(H,13,14,16) |
| InChIKey | GZNGEALDWTVPPT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|