C35H74ClNO — CID 175356300
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol;methyl(trioctyl)azanium;chloride (PubChem CID 175356300) has the molecular formula C35H74ClNO and a molecular weight of 560.44 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol;methyl(trioctyl)azanium;chloride.
| Compound Name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol;methyl(trioctyl)azanium;chloride |
|---|---|
| PubChem CID | 175356300 |
| Molecular Formula | C35H74ClNO |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.55 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol;methyl(trioctyl)azanium;chloride |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C25H54N.C10H20O.ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-7(2)9-5-4-8(3)6-10(9)11;/h5-25H2,1-4H3;7-11H,4-6H2,1-3H3;1H/q+1;;/p-1/t;8-,9+,10-;/m.1./s1 |
| InChIKey | SJBNTNYAECFMLK-BNQZSFGLSA-M |
| XLogP | 7.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|